For research use only. Not for therapeutic Use.
3-Fluoro-N-methoxy-N-methylbenzamide(Cat No.:L014899)is a fluorinated benzamide derivative used in pharmaceutical research and organic synthesis. This compound features a fluorine atom at the 3-position of the benzene ring, with N-methoxy and N-methyl groups attached to the amide functional group. It is commonly used as an intermediate in the synthesis of bioactive molecules, including potential drug candidates. The combination of the fluorine atom and the N-methoxy-N-methyl structure enhances the compound’s reactivity and allows for precise modifications, making it valuable in medicinal chemistry and drug development.
CAS Number | 226260-01-1 |
Molecular Formula | C9H10FNO2 |
Purity | ≥95% |
IUPAC Name | 3-fluoro-N-methoxy-N-methylbenzamide |
InChI | InChI=1S/C9H10FNO2/c1-11(13-2)9(12)7-4-3-5-8(10)6-7/h3-6H,1-2H3 |
InChIKey | RQOXEMMAAVCMRU-UHFFFAOYSA-N |
SMILES | CN(C(=O)C1=CC(=CC=C1)F)OC |