For research use only. Not for therapeutic Use.
3-Fluorobenzonitrile(CAT: L011367) is an aromatic compound characterized by a fluorine atom at the 3-position and a nitrile group on the benzene ring. This versatile compound is widely utilized in pharmaceutical and chemical research as a key building block for the synthesis of bioactive molecules, agrochemicals, and advanced materials. The presence of both the fluorine and nitrile groups enhances its reactivity and allows for diverse chemical modifications. With high purity and stability, 3-Fluorobenzonitrile is an essential intermediate for researchers developing innovative solutions in medicinal chemistry, materials science, and organic synthesis.
| Catalog Number | L011367 |
| CAS Number | 403-54-3 |
| Molecular Formula | C7H4FN |
| Purity | ≥95% |
| IUPAC Name | 3-fluorobenzonitrile |
| InChI | InChI=1S/C7H4FN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| InChIKey | JZTPKAROPNTQQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C#N |
