For research use only. Not for therapeutic Use.
3-Fluorobenzyl isothiocyanate（Cat No.:L007102）, is a chemical compound represented by the formula C8H6FNS. It is a member of the isothiocyanate family, characterized by the presence of the N=C=S functional group. This compound is used in various chemical reactions and synthesis processes, owing to its reactivity and ability to modify biomolecules. Isothiocyanates are known for their potential biological activities, including anticancer properties, making them valuable in pharmaceutical research. The specific applications and research related to 3-Fluorobenzyl isothiocyanate contribute to advancements in medicinal chemistry and drug discovery.
| Catalog Number | L007102 |
| CAS Number | 63351-94-0 |
| Molecular Formula | C8H6FNS |
| Purity | ≥95% |
| IUPAC Name | 1-fluoro-3-(isothiocyanatomethyl)benzene |
| InChI | InChI=1S/C8H6FNS/c9-8-3-1-2-7(4-8)5-10-6-11/h1-4H,5H2 |
| InChIKey | CCKNPKNHNFDGND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CN=C=S |
