For research use only. Not for therapeutic Use.
(3-Fluorophenyl)Methanamine Hydrochloride (Cat.No:L003543) is a significant chemical compound with diverse applications in pharmaceutical research. Its structure, incorporating a fluorophenyl group, imparts unique properties relevant in drug development. This compound serves as a crucial intermediate in the synthesis of various pharmaceutical agents.
CAS Number | 658-25-3 |
Molecular Formula | C7H9ClFN |
Purity | ≥95% |
IUPAC Name | (3-fluorophenyl)methanamine;hydrochloride |
InChI | InChI=1S/C7H8FN.ClH/c8-7-3-1-2-6(4-7)5-9;/h1-4H,5,9H2;1H |
InChIKey | WJWIVRLHEIMOFX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)F)CN.Cl |