For research use only. Not for therapeutic Use.
3-Fluoroquinolin-7-ol(CAT: L027636) is a high-purity heterocyclic compound featuring a fluorine atom at position 3 and a hydroxyl group at position 7 on a quinoline core. This structure makes it a valuable intermediate in pharmaceutical research and organic synthesis, particularly for the development of bioactive molecules, small-molecule inhibitors, and therapeutic candidates. The hydroxyl group provides versatility for further derivatization, while the fluorine substitution enhances metabolic stability and bioavailability. 3-Fluoroquinolin-7-ol is ideal for precision synthesis in medicinal chemistry, enabling the creation of complex heterocycles and fluorinated compounds for both academic and industrial research applications.
CAS Number | 288384-55-4 |
Molecular Formula | C9H6FNO |
Purity | ≥95% |
IUPAC Name | 3-fluoroquinolin-7-ol |
InChI | InChI=1S/C9H6FNO/c10-7-3-6-1-2-8(12)4-9(6)11-5-7/h1-5,12H |
InChIKey | PWYWRUGPXKKQEE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=NC=C(C=C21)F)O |