For research use only. Not for therapeutic Use.
3-Formylphenylboronic acid (Cat No.:R026011) is a chemical compound. It features a phenylboronic acid core substituted with a formyl group. This compound is significant in organic synthesis and chemical research as a versatile building block for creating various molecules. Phenylboronic acids are widely used in Suzuki-Miyaura coupling reactions and other transformations to form carbon-carbon bonds. The presence of a formyl group adds reactivity and functional diversity to the compound. 3-Formylphenylboronic acid’s role as a synthetic intermediate contributes to the construction of complex structures for applications in drug discovery and materials science, supporting scientific advancements.
CAS Number | 87199-16-4 |
Synonyms | B-(3-Formylphenyl)boronic Acid; (3-Formylbenzene)boronic Acid; m-Formylphenylboronic Acid |
Molecular Formula | C7H7BO3 |
Purity | ≥95% |
Storage | Inert atmosphere,2-8°C |
IUPAC Name | (3-formylphenyl)boronic acid |
InChI | InChI=1S/C7H7BO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-5,10-11H |
InChIKey | HJBGZJMKTOMQRR-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC=C1)C=O)(O)O |