For research use only. Not for therapeutic Use.
3-Fucosyllactose (Cat No.:R068569) is a human milk oligosaccharide (HMO) composed of L-fucose, D-galactose, and D-glucose. It plays a crucial role in infant nutrition, gut microbiota modulation, and immune system support. As a prebiotic, 3-FL promotes the growth of beneficial bifidobacteria, enhancing digestive health and protecting against pathogens. It is also studied for its potential in anti-inflammatory, antimicrobial, and cognitive health applications. Due to its structural similarity to host cell receptors, 3-FL can inhibit pathogen adhesion, making it valuable in functional food, pharmaceutical, and nutraceutical research for gut and immune health.
| CAS Number | 41312-47-4 |
| Synonyms | (2R,3R,4R,5R)-2,5,6-trihydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexanal |
| Molecular Formula | C18H32O15 |
| Purity | ≥95% |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(3R,4R,5R,6R)-2,3-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
| InChI | InChI=1S/C18H32O15/c1-4-7(21)9(23)11(25)17(29-4)33-15-13(27)16(28)30-6(3-20)14(15)32-18-12(26)10(24)8(22)5(2-19)31-18/h4-28H,2-3H2,1H3/t4-,5+,6+,7+,8-,9+,10-,11-,12+,13+,14+,15+,16?,17-,18-/m0/s1 |
| InChIKey | WJPIUUDKRHCAEL-YVEAQFMBSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@H]2[C@@H]([C@H](OC([C@@H]2O)O)CO)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
