For research use only. Not for therapeutic Use.
3-Hexyn-2-ol (Cat No.:R062847) is a chemical compound. It features a hydroxyl group attached to a hexynyl chain. This compound is important in organic synthesis and chemical research due to its potential applications in various reactions. Alkynyl alcohols like 3-hexyn-2-ol are versatile reagents for creating diverse molecules, including pharmaceuticals and functional materials. The presence of a triple bond in the carbon chain adds unique reactivity and functional diversity to the compound. 3-Hexyn-2-ol’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 109-50-2 |
Synonyms | 2-Hydroxy-3-hexyne; |
Molecular Formula | C6H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | hex-3-yn-2-ol |
InChI | InChI=1S/C6H10O/c1-3-4-5-6(2)7/h6-7H,3H2,1-2H3 |
InChIKey | IFCAMPHNVKBSTF-UHFFFAOYSA-N |
SMILES | CCC#CC(C)O |