For research use only. Not for therapeutic Use.
3-Hydrazino-quinoxaline-2-thiol(Cat No.:M058821)is a heterocyclic compound with potential applications in medicinal chemistry and pharmaceutical research. Known for its quinoxaline core, this compound possesses both hydrazino and thiol functional groups, which contribute to its reactivity and ability to interact with biological molecules. Studies suggest that 3-Hydrazino-quinoxaline-2-thiol may exhibit antimicrobial, anticancer, and antioxidant properties, making it a candidate for further drug development and biochemical research. Its unique structure allows it to serve as a building block in synthesizing various biologically active compounds, enhancing its value in chemical and pharmaceutical studies.
Catalog Number | M058821 |
CAS Number | 13080-21-2 |
Molecular Formula | C8H8N4S |
Purity | ≥95% |
Target | Bacterial |
Storage | -80°C |
IUPAC Name | 3-hydrazinyl-1H-quinoxaline-2-thione |
InChI | InChI=1S/C8H8N4S/c9-12-7-8(13)11-6-4-2-1-3-5(6)10-7/h1-4H,9H2,(H,10,12)(H,11,13) |
InChIKey | TVYAHCDRRICQJM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=S)C(=N2)NN |