3-Hydroxy-2-methoxyisonicotinic acid(CAT: L000317) is a compound of significant importance in pharmaceutical and organic chemistry. This chemical serves as a crucial intermediate in the synthesis of pharmaceutical compounds, particularly those designed for their potential in treating various diseases. Its primary target is the development of drugs that can modulate specific biological pathways or receptors.
Catalog Number | L000317 |
CAS Number | 1256802-56-8 |
Molecular Formula | C7H7NO4 |
Purity | 95% |
IUPAC Name | 3-hydroxy-2-methoxypyridine-4-carboxylic acid |
InChI | InChI=1S/C7H7NO4/c1-12-6-5(9)4(7(10)11)2-3-8-6/h2-3,9H,1H3,(H,10,11) |
InChIKey | QCJHWMWYRWCKSM-UHFFFAOYSA-N |