For research use only. Not for therapeutic Use.
3-Hydroxy-2-methylbutanoic Acid is a high-purity compound extensively used in pharmaceutical and biochemical research. Known for its crucial role in metabolic studies, this compound is essential for understanding biochemical pathways and developing novel therapeutics. Its stability and consistency ensure reliable results in various experimental applications. Ideal for drug development and metabolic analysis, 3-Hydroxy-2-methylbutanoic Acid supports advanced research, offering precise and dependable performance for scientists and researchers in the pharmaceutical industry.
| Catalog Number | R012232 |
| CAS Number | 473-86-9 |
| Synonyms | 2-Methyl-3-hydroxybutyric Acid; 3-Hydroxy-2-methylbutyric Acid; Nilic Acid; α-Methyl-β-hydroxybutyric Acid; |
| Molecular Formula | C5H10O3 |
| Purity | ≥95% |
| Storage | -20 ℃ |
| IUPAC Name | 3-hydroxy-2-methylbutanoic acid |
| InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8) |
| InChIKey | VEXDRERIMPLZLU-UHFFFAOYSA-N |
| SMILES | CC(C(C)O)C(=O)O |
