For research use only. Not for therapeutic Use.
3-Hydroxy-2,7-naphthalenedicarboxylic acid(Cat No.:M037821) is an aromatic dicarboxylic acid derivative of naphthalene, characterized by carboxyl groups at the 2 and 7 positions and a hydroxyl group at the 3 positions. This structure makes it a useful intermediate in the synthesis of polymers, dyes, and pigments. The presence of both carboxyl and hydroxyl groups on the naphthalene ring enhances its reactivity, allowing for further functionalization and incorporation into complex molecules. It is particularly valued in materials science for developing advanced polymers with specific optical and electronic properties, enhancing their utility in various industrial applications.
Catalog Number | M037821 |
CAS Number | 160592-73-4 |
Synonyms | 3-HYDROXY-2,7-NAPHTHALENEDICARBOXYLIC ACID |
Molecular Formula | C12H8O5 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-hydroxynaphthalene-2,7-dicarboxylic acid |
InChI | InChI=1S/C12H8O5/c13-10-5-6-1-2-7(11(14)15)3-8(6)4-9(10)12(16)17/h1-5,13H,(H,14,15)(H,16,17) |
InChIKey | TVBXXOVRWRDFMB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=CC(=C(C=C21)O)C(=O)O)C(=O)O |