For research use only. Not for therapeutic Use.
Isovanillin(Cat No.:R006104), also known as 5-Formylguaiacol, 3-Hydroxy-p-anisaldehyde, or 3-Hydroxy-4-methoxybenzaldehyde, is a compound that acts as a reversible inhibitor of aldehyde dehydrogenase. It finds widespread use as a pharmaceutical intermediate in various industries, including the food and beverage industry, chemical synthesis of flavors, and chemical analysis. Isovanillin contributes to the development of flavors and is employed as a key ingredient in food products, fragrances, and cosmetics. Its inhibitory effect on aldehyde dehydrogenase makes it useful in certain therapeutic applications.
CAS Number | 621-59-0 |
Synonyms | Isovanillin; 3-Hydroxyanisaldehyde; 5-Formylguaiacol; 5-Formyl-2-methoxyphenol; 2-Methoxy-5-formylphenol; NSC 82996 |
Molecular Formula | C8H8O3 |
Purity | ≥95% |
Target | Plants |
Storage | RT |
IUPAC Name | 3-hydroxy-4-methoxybenzaldehyde |
InChI | InChI=1S/C8H8O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-5,10H,1H3 |
InChIKey | JVTZFYYHCGSXJV-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C=O)O |