For research use only. Not for therapeutic Use.
3-Hydroxy-4-methoxycinnamic Acid (Isoferulic Acid)(Cat No.:R007320)is a naturally occurring phenolic compound with antioxidant, anti-inflammatory, and antimicrobial properties. It is structurally related to ferulic acid and is found in various plants, including rice bran and other cereals. Isoferulic acid has been studied for its potential in protecting cells against oxidative stress and its role in preventing chronic diseases, such as cardiovascular conditions and cancer. It also exhibits skin-protective effects, making it a valuable ingredient in cosmetic formulations aimed at reducing skin aging and damage from UV radiation.
CAS Number | 537-73-5 |
Synonyms | 3-(3-Hydroxy-4-methoxyphenyl)acrylic Acid; Isoferulic Acid; 3-(3-Hydroxy-4-methoxyphenyl)-2-propenoic Acid; |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
InChIKey | QURCVMIEKCOAJU-HWKANZROSA-N |
SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |