For research use only. Not for therapeutic Use.
3-Hydroxy benzopyrene is a metabolite of benzopyrene, a polycyclic aromatic hydrocarbon commonly found in tobacco smoke, grilled foods, and exhaust fumes. It is formed through the action of cytochrome P450 enzymes in the liver. This hydroxylated derivative exhibits increased reactivity compared to benzopyrene, enabling it to form DNA adducts and potentially contribute to the carcinogenicity of benzopyrene. Research on 3-hydroxy benzopyrene explores its genotoxicity, metabolism, and role in cancer development.
| Catalog Number | R047638 |
| CAS Number | 13345-21-6 |
| Synonyms | Benzo[a]pyren-3-ol; 3-Hydroxy-3,4-benzo[a]pyrene; 3-Hydroxybenzo[a]pyrene; |
| Molecular Formula | C20H12O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | benzo[a]pyren-3-ol |
| InChI | InChI=1S/C20H12O/c21-18-10-7-12-5-8-16-15-4-2-1-3-13(15)11-14-6-9-17(18)19(12)20(14)16/h1-11,21H |
| InChIKey | SPUUWWRWIAEPDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C4C(=CC2=C1)C=CC5=C(C=CC(=C54)C=C3)O |
