For research use only. Not for therapeutic Use.
3-Hydroxybenzaldehyde (Cat. No: R004621) is a chemical reagent, mainly used as an intermediate in the manufacture of medicine, spices and dyes. The drugs synthesized from 3-Hydroxybenzaldehyde mainly include dehydroxylated adrenaline hydrochloride, adrenaline, quinine, otocaine and so on.
| Catalog Number | R004621 |
| CAS Number | 100-83-4 |
| Synonyms | 3-Formylphenol; NSC 3504; |
| Molecular Formula | C7H6O2 |
| Purity | ≥95% |
| Target | Aldehyde Dehydrogenase (ALDH) |
| Storage | -20°C |
| IUPAC Name | 3-hydroxybenzaldehyde |
| InChI | InChI=1S/C7H6O2/c8-5-6-2-1-3-7(9)4-6/h1-5,9H |
| InChIKey | IAVREABSGIHHMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C=O |
