For research use only. Not for therapeutic Use.
3-Hydroxycinnamic acid (Cat No: M066047) is a natural phenolic compound found in various plants. It exhibits antioxidant and anti-inflammatory properties, and is studied for its potential health benefits. Additionally, it serves as a precursor in the biosynthesis of flavonoids and lignans, contributing to plant defense mechanisms and human nutrition.
CAS Number | 14755-02-3 |
Molecular Formula | C9H8O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (E)-3-(3-hydroxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4+ |
InChIKey | KKSDGJDHHZEWEP-SNAWJCMRSA-N |
SMILES | C1=CC(=CC(=C1)O)C=CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |