For research use only. Not for therapeutic Use.
3-Hydroxycyclobutanecarboxylic acid is a small, cyclic compound with a hydroxy group and a carboxylic acid functional group attached to a four-membered cyclobutane ring. Its strained ring structure and reactive functional groups make it an important intermediate in pharmaceutical and organic synthesis research. This compound is valuable in developing biologically active molecules, especially those targeting metabolic pathways and enzyme inhibition. Its unique properties allow for versatile applications in drug design, particularly in optimizing molecular interactions and improving pharmacokinetic profiles.
CAS Number | 194788-10-8 |
Molecular Formula | C5H8O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 3-hydroxycyclobutane-1-carboxylic acid |
InChI | InChI=1S/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8) |
InChIKey | ZSHGVMYLGGANKU-UHFFFAOYSA-N |
SMILES | C1C(CC1O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |