For research use only. Not for therapeutic Use.
3-Hydroxyflavone is a flavone compound with a hydroxyl group (-OH) attached to the 3-position of the flavone backbone. It belongs to the flavonoid family, widely distributed in plants and known for their diverse biological activities. 3-Hydroxyflavone exhibits antioxidant properties, scavenging free radicals and protecting cells from oxidative damage. Moreover, it demonstrates potential therapeutic effects, including anti-inflammatory, anticancer, and neuroprotective activities. Research suggests its involvement in modulating various cellular pathways, making it a promising candidate for the development of pharmaceuticals targeting oxidative stress-related diseases.
CAS Number | 577-85-5 |
Synonyms | 3-Flavonol |
Molecular Formula | C15H10O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | RT |
IUPAC Name | 3-hydroxy-2-phenylchromen-4-one |
InChI | InChI=1S/C15H10O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-9,17H |
InChIKey | HVQAJTFOCKOKIN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |