For research use only. Not for therapeutic Use.
3-Hydroxypropyl 3,4-difluorobenzoate(CAT: L000468) is a significant compound in the realm of organic chemistry, particularly in the synthesis of organic molecules. This compound serves as a versatile building block, finding applications in various fields, including pharmaceutical, agrochemical, and material chemistry. Its unique structure and reactivity make it a valuable tool for chemists and researchers, enabling the creation of a wide range of organic compounds for different purposes.
CAS Number | 684648-49-5 |
Molecular Formula | C10H10F2O3 |
Purity | ≥95% |
IUPAC Name | 3-hydroxypropyl 3,4-difluorobenzoate |
InChI | InChI=1S/C10H10F2O3/c11-8-3-2-7(6-9(8)12)10(14)15-5-1-4-13/h2-3,6,13H,1,4-5H2 |
InChIKey | GHGKRZNQJIGXGV-UHFFFAOYSA-N |