3-Hydroxypyruvic Acid-13C2 is a carbon-13 labeled derivative of 3-hydroxypyruvic acid, a key intermediate in metabolic pathways, particularly in amino acid metabolism and glycolysis. The incorporation of carbon-13 isotopes allows for detailed tracing and analysis in metabolic studies using NMR and mass spectrometry. This compound is essential for research in biochemistry and pharmaceutical sciences, as it aids in elucidating metabolic pathways, enzyme mechanisms, and the effects of drugs on metabolic processes. Its use in isotope labeling provides valuable insights into the dynamic biochemical interactions within living organisms.
Catalog Number | R022322 |
CAS Number | 1113-60-6 |
Synonyms | 3-Hydroxy-2-oxopropanoic-2,3-13C2 Acid; [2,3-13C2]-3-Hydroxypyruvic Acid; |
Molecular Formula | C3H4O4 |
Purity | 0% |
Storage | -20°C |
IUPAC Name | 3-hydroxy-2-oxopropanoic acid |
InChI | InChI=1S/C3H4O4/c4-1-2(5)3(6)7/h4H,1H2,(H,6,7)/i1+1,2+1 |
InChIKey | HHDDCCUIIUWNGJ-ZDOIIHCHSA-N |
SMILES | C(C(=O)C(=O)O)O |