For research use only. Not for therapeutic Use.
3-Hydroxysuberic Acid (Cat.No:R036048) is a chemical compound that belongs to the class of dicarboxylic acids. It is used as a building block in organic synthesis and serves as a precursor in the production of various chemicals, including pharmaceuticals, polymers, and agrochemicals. Its versatile reactivity makes it valuable in chemical research and industry.
CAS Number | 73141-47-6 |
Synonyms | 3-Hydroxyoctanedioic Acid; |
Molecular Formula | C8H14O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-hydroxyoctanedioic acid |
InChI | InChI=1S/C8H14O5/c9-6(5-8(12)13)3-1-2-4-7(10)11/h6,9H,1-5H2,(H,10,11)(H,12,13) |
InChIKey | ARJZZFJXSNJKGR-UHFFFAOYSA-N |
SMILES | C(CCC(=O)O)CC(CC(=O)O)O |