For research use only. Not for therapeutic Use.
3-Indoleacetonitrile(Cat No.:I015077) is a compound that acts as a plant hormone known as auxin. Auxins are involved in various physiological processes in plants, including growth and development. Additionally, 3-Indoleacetonitrile exhibits a unique property as a light-induced auxin-inhibiting sex hormone. It plays a role in regulating sexual development in certain plants, potentially influencing processes such as flowering and reproduction. The dual nature of 3-Indoleacetonitrile as an auxin and a light-induced auxin-inhibiting sex hormone highlights its multifaceted role in plant physiology and reproduction.
CAS Number | 771-51-7 |
Molecular Formula | C₁₀H₈N₂ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room Temperature |
IUPAC Name | 2-(1H-indol-3-yl)acetonitrile |
InChI | InChI=1S/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
InChIKey | DMCPFOBLJMLSNX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)CC#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |