For research use only. Not for therapeutic Use.
3-Iodo-2-methoxyisonicotinonitrile(CAT: L034184) is an organic compound that features an iodine atom at the 3-position, a methoxy group (-OCH₃) at the 2-position, and a nitrile group (-CN) attached to a pyridine ring (isonicotinonitrile). The combination of these functional groups provides the molecule with unique reactivity, particularly in cross-coupling reactions, such as Sonogashira or Suzuki coupling, where the iodine atom acts as a good leaving group. The methoxy group can influence the electronic properties of the ring system, while the nitrile group adds a polar functionality, often used in the development of pharmaceuticals or fine chemicals. This compound serves as a versatile building block in organic synthesis, particularly in medicinal chemistry for drug development.
CAS Number | 908279-57-2 |
Molecular Formula | C7H5IN2O |
Purity | ≥95% |
IUPAC Name | 3-iodo-2-methoxypyridine-4-carbonitrile |
InChI | InChI=1S/C7H5IN2O/c1-11-7-6(8)5(4-9)2-3-10-7/h2-3H,1H3 |
InChIKey | NKOLCZUNZRIELF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |