For research use only. Not for therapeutic Use.
3-Iodo-2-methylphenylacetonitrile is an aromatic compound featuring a phenyl ring with an iodine atom at the 3-position, a methyl group at the 2-position, and an acetonitrile (-CH₂CN) group attached at the 1-position. The iodine substitution offers increased reactivity for nucleophilic substitution reactions, while the acetonitrile group provides a useful nitrile functionality. This compound serves as a key intermediate in organic synthesis, particularly for the production of pharmaceuticals, agrochemicals, and other bioactive molecules with potential antimicrobial or anticancer properties.
CAS Number | 1261569-73-6 |
Molecular Formula | C9H8IN |
Purity | ≥95% |
IUPAC Name | 2-(3-iodo-2-methylphenyl)acetonitrile |
InChI | InChI=1S/C9H8IN/c1-7-8(5-6-11)3-2-4-9(7)10/h2-4H,5H2,1H3 |
InChIKey | ASXSGRWJIRQOIR-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1I)CC#N |