For research use only. Not for therapeutic Use.
3-Iodo-2-nitroaniline(Cat No.:L021288)is a critical intermediate in organic synthesis, widely used in pharmaceutical and chemical research. This compound features an iodine atom and a nitro group attached to an aniline ring, making it a versatile building block for the creation of complex molecules. Its unique reactivity allows for the synthesis of various derivatives, particularly in the development of new drugs and dyes. 3-Iodo-2-nitroaniline plays a vital role in advancing medicinal chemistry, offering researchers a reliable tool for high-precision synthesis and innovative chemical investigations.
CAS Number | 721925-17-3 |
Molecular Formula | C6H5IN2O2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-2-nitroaniline |
InChI | InChI=1S/C6H5IN2O2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H,8H2 |
InChIKey | YURLZSSAVLKVNB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)I)[N+](=O)[O-])N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |