For research use only. Not for therapeutic Use.
3-Iodo-4-isopropylbenzoic acid(CAT: L033966) is a halogenated aromatic compound commonly used in pharmaceutical and chemical research. Featuring an iodine atom at the 3-position and an isopropyl group at the 4-position on a benzoic acid scaffold, this compound is a versatile building block for synthesizing bioactive molecules, agrochemicals, and advanced materials. Its unique structure makes it particularly valuable in cross-coupling reactions, functional group transformations, and the exploration of structure-activity relationships (SAR). With high purity and consistent performance, 3-Iodo-4-isopropylbenzoic acid supports innovative research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 99059-64-0 |
Molecular Formula | C10H11IO2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-4-propan-2-ylbenzoic acid |
InChI | InChI=1S/C10H11IO2/c1-6(2)8-4-3-7(10(12)13)5-9(8)11/h3-6H,1-2H3,(H,12,13) |
InChIKey | YKYRHJJXCOILPA-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C=C(C=C1)C(=O)O)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |