For research use only. Not for therapeutic Use.
3′-Iodo-5′-bromoacetophenone (Cat.No:L004153) is a significant chemical compound with diverse applications. Its distinct structure, featuring iodine and bromine substituents, imparts specialized reactivity. This compound is employed as a key intermediate in the synthesis of specialized organic molecules, particularly in pharmaceutical and chemical research.
| Catalog Number | L004153 |
| CAS Number | 1003712-14-8 |
| Molecular Formula | C8H6BrIO |
| Purity | ≥95% |
| IUPAC Name | 1-(3-bromo-5-iodophenyl)ethanone |
| InChI | InChI=1S/C8H6BrIO/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3 |
| InChIKey | ZTUMZGVEBVJSBY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)I)Br |
