For research use only. Not for therapeutic Use.
3-Iodo-5-methoxy-1H-pyrazolo[4,3-b]pyridine(Cat No.:L012273)is a heterocyclic compound featuring an iodine atom at the 3-position and a methoxy group at the 5-position on a pyrazolopyridine ring system. This compound is widely used in pharmaceutical research and organic synthesis as a building block for the development of biologically active molecules, including potential drug candidates. Its iodine and methoxy groups provide versatile reactivity, making it suitable for cross-coupling reactions and other chemical transformations. Researchers in medicinal chemistry utilize this compound to create novel therapeutic agents and explore new drug discovery pathways.
CAS Number | 1134328-05-4 |
Molecular Formula | C7H6IN3O |
Purity | ≥95% |
IUPAC Name | 3-iodo-5-methoxy-2H-pyrazolo[4,3-b]pyridine |
InChI | InChI=1S/C7H6IN3O/c1-12-5-3-2-4-6(9-5)7(8)11-10-4/h2-3H,1H3,(H,10,11) |
InChIKey | IKJCYTWAGMLTML-UHFFFAOYSA-N |
SMILES | COC1=NC2=C(NN=C2C=C1)I |