For research use only. Not for therapeutic Use.
3-Iodo-5-(trifluoromethoxy)-1H-indazole is a heterocyclic compound featuring an indazole core with an iodine atom at the third position and a trifluoromethoxy group at the fifth position. The trifluoromethoxy substitution enhances the compound’s stability and reactivity, making it useful in various synthetic applications. This compound is of interest in pharmaceutical research for its potential biological activities, including antimicrobial and anticancer properties. Its unique structure offers opportunities for the development of novel therapeutics and materials in medicinal chemistry.
Catalog Number | L025513 |
CAS Number | 1426423-96-2 |
Molecular Formula | C8H4F3IN2O |
Purity | ≥95% |
IUPAC Name | 3-iodo-5-(trifluoromethoxy)-2H-indazole |
InChI | InChI=1S/C8H4F3IN2O/c9-8(10,11)15-4-1-2-6-5(3-4)7(12)14-13-6/h1-3H,(H,13,14) |
InChIKey | KCJAKLOGYIQMHQ-UHFFFAOYSA-N |
SMILES | C1=CC2=NNC(=C2C=C1OC(F)(F)F)I |