For research use only. Not for therapeutic Use.
3-Iodo-7-azaindole-5-carboxylic Acid(Cat No.:L027258)is a distinctive organic compound used primarily as an intermediate in pharmaceutical synthesis. The azaindole core is a nitrogen-containing heterocycle that mirrors the structural and electronic properties of indoles, widely utilized in drug development. The 3-iodo substitution facilitates cross-coupling reactions, essential for constructing complex organic frameworks. The carboxylic acid group at the 5-position enhances solubility and provides a functional handle for further chemical modification, such as esterification or amide formation. This compound is instrumental in creating novel therapeutics, particularly in oncology and CNS disorders.
CAS Number | 1060816-80-9 |
Molecular Formula | C8H5IN2O2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
InChI | InChI=1S/C8H5IN2O2/c9-6-3-11-7-5(6)1-4(2-10-7)8(12)13/h1-3H,(H,10,11)(H,12,13) |
InChIKey | FNQBSSMJOSBURI-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=C1C(=CN2)I)C(=O)O |