For research use only. Not for therapeutic Use.
3-Iodo-7-methoxy-1H-indazole(CAT: L039250) is an iodinated heterocyclic compound widely used in pharmaceutical research and organic synthesis. Its structure features an indazole core with an iodine atom at the 3-position and a methoxy group at the 7-position, providing unique electronic and steric properties. This compound serves as a key intermediate in the development of kinase inhibitors, receptor modulators, and other bioactive molecules. The iodine substitution facilitates cross-coupling reactions, enabling further functionalization. Researchers utilize 3-Iodo-7-methoxy-1H-indazole in medicinal chemistry and structure-activity relationship (SAR) studies, making it a crucial tool for designing innovative therapeutic agents.
CAS Number | 351210-07-6 |
Molecular Formula | C8H7IN2O |
Purity | ≥95% |
IUPAC Name | 3-iodo-7-methoxy-2H-indazole |
InChI | InChI=1S/C8H7IN2O/c1-12-6-4-2-3-5-7(6)10-11-8(5)9/h2-4H,1H3,(H,10,11) |
InChIKey | CDMLCUJEOMSFDX-UHFFFAOYSA-N |
SMILES | COC1=CC=CC2=C(NN=C21)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |