For research use only. Not for therapeutic Use.
3-Iodo-7-methyl-1H-indazole(CAT: L014859) is a high-purity heterocyclic compound featuring an indazole core substituted with an iodine atom at position 3 and a methyl group at position 7. This unique structure makes it an essential intermediate in pharmaceutical research and organic synthesis, particularly for the development of bioactive molecules, kinase inhibitors, and advanced therapeutic agents. The iodine substitution allows for further functionalization via cross-coupling reactions, such as Suzuki or Sonogashira coupling, facilitating the synthesis of complex derivatives. 3-Iodo-7-methyl-1H-indazole is ideal for medicinal chemistry applications, offering stability, reactivity, and precision in both academic and industrial research settings.
CAS Number | 847906-27-8 |
Molecular Formula | C8H7IN2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-7-methyl-2H-indazole |
InChI | InChI=1S/C8H7IN2/c1-5-3-2-4-6-7(5)10-11-8(6)9/h2-4H,1H3,(H,10,11) |
InChIKey | WYUIOANIHMLVPU-UHFFFAOYSA-N |
SMILES | CC1=CC=CC2=C(NN=C12)I |