For research use only. Not for therapeutic Use.
3-Iodo-N-methylpyridin-2-amine(Cat No.:L002706)is a halogenated heterocyclic compound used in pharmaceutical and chemical research. Featuring a pyridine ring with an iodine atom at the 3-position and a methylamino group at the 2-position, this compound serves as a valuable intermediate in synthesizing bioactive molecules, including potential drug candidates. Its structure allows for selective chemical modifications, making it essential in the development of complex organic compounds. Additionally, it is used in the design of advanced materials and fine chemicals, contributing to innovations in medicinal chemistry and material science.
CAS Number | 113975-23-8 |
Molecular Formula | C6H7IN2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-N-methylpyridin-2-amine |
InChI | InChI=1S/C6H7IN2/c1-8-6-5(7)3-2-4-9-6/h2-4H,1H3,(H,8,9) |
InChIKey | MVFOZPUJBFFGFO-UHFFFAOYSA-N |
SMILES | CNC1=C(C=CC=N1)I |