For research use only. Not for therapeutic Use.
3-Iodo-N-methylpyridin-4-amine is an iodinated pyridine derivative with an iodine atom at the 3-position and an N-methylated amino group at the 4-position. This compound is commonly utilized in organic synthesis and pharmaceutical research due to its reactivity and potential for further functionalization. The iodine substituent facilitates cross-coupling reactions, making it a versatile intermediate in constructing complex bioactive molecules. Its structure supports efficient synthetic pathways, particularly in drug development and advanced chemical research applications.
Catalog Number | L020482 |
CAS Number | 680859-97-6 |
Molecular Formula | C6H7IN2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-N-methylpyridin-4-amine |
InChI | InChI=1S/C6H7IN2/c1-8-6-2-3-9-4-5(6)7/h2-4H,1H3,(H,8,9) |
InChIKey | NAGJYUCEJFOXDF-UHFFFAOYSA-N |
SMILES | CNC1=C(C=NC=C1)I |