For research use only. Not for therapeutic Use.
3-Iodobiphenyl is a useful chemical for chemical synthesis.
| Catalog Number | I020894 |
| CAS Number | 20442-79-9 |
| Synonyms | 3-Iodobiphenyl |
| Molecular Formula | C12H9I |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1,1'-Biphenyl, 3-iodo- |
| InChI | InChI=1S/C12H9I/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| InChIKey | KAQUBIATNWQNRE-UHFFFAOYSA-N |
| SMILES | IC1=CC(C2=CC=CC=C2)=CC=C1 |
