For research use only. Not for therapeutic Use.
3-Iodonaphthalen-1-amine(Cat No.:L007363), is a chemical compound essential in organic synthesis and pharmaceutical research. It contains an amino group attached to the first carbon of a naphthalene ring, with an iodine atom occupying the third position. This structure makes it a vital building block in the creation of various organic compounds, including pharmaceuticals and specialty chemicals. Chemists employ it as a key intermediate in the synthesis of complex molecules due to its reactivity and versatility. Its applications contribute significantly to the development of new drugs and the advancement of chemical research.
CAS Number | 90841-85-3 |
Molecular Formula | C10H8IN |
Purity | ≥95% |
IUPAC Name | 3-iodonaphthalen-1-amine |
InChI | InChI=1S/C10H8IN/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6H,12H2 |
InChIKey | WVPWDYVGTSSPHY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C(C=C2N)I |