For research use only. Not for therapeutic Use.
3-Iodophenyl acetate is an organic compound characterized by an acetate group attached to a phenyl ring that bears an iodine atom at the 3-position. This structure imparts unique electronic properties and enhances its reactivity, making it valuable in organic synthesis. The iodine substituent can facilitate various reactions, such as nucleophilic substitution and cross-coupling, useful in the development of pharmaceuticals and agrochemicals. Additionally, its acetate group enhances solubility, allowing for diverse applications in chemical research and synthesis.
CAS Number | 42861-71-2 |
Molecular Formula | C8H7IO2 |
Purity | ≥95% |
IUPAC Name | (3-iodophenyl) acetate |
InChI | InChI=1S/C8H7IO2/c1-6(10)11-8-4-2-3-7(9)5-8/h2-5H,1H3 |
InChIKey | LWGMUQGQHHKINA-UHFFFAOYSA-N |
SMILES | CC(=O)OC1=CC(=CC=C1)I |