For research use only. Not for therapeutic Use.
3-Iodophenylacetonitrile is an organic compound characterized by a phenyl ring (a benzene derivative) attached to an acetonitrile group (-CH2CN) with an iodine atom substituted at the third position on the phenyl ring. This compound is commonly used in organic synthesis, especially in the preparation of pharmaceuticals and agrochemicals. Its iodine atom allows for further chemical modification, making it useful in reactions like cross-coupling. It’s a key intermediate for creating more complex molecules in medicinal chemistry.
| Catalog Number | M119105 |
| CAS Number | 130723-54-5 |
| Molecular Formula | C8H6IN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(3-iodophenyl)acetonitrile |
| InChI | InChI=1S/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| InChIKey | LVOKGAHCTHNWIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)CC#N |
