For research use only. Not for therapeutic Use.
3-Iodopyridine-2-carbonitrile(Cat No.:L044818)is a chemical compound with the molecular formula C6H3IN2. It features a pyridine ring substituted with an iodine atom at the 3-position and a nitrile group at the 2-position. This structure is particularly useful in pharmaceutical and agrochemical synthesis due to its ability to undergo various types of chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The iodine and nitrile groups make it a versatile intermediate for synthesizing more complex molecules, contributing significantly to the development of new therapeutic agents and agricultural chemicals with improved efficacy and safety profiles.
CAS Number | 827616-52-4 |
Molecular Formula | C6H3IN2 |
Purity | ≥95% |
IUPAC Name | 3-iodopyridine-2-carbonitrile |
InChI | InChI=1S/C6H3IN2/c7-5-2-1-3-9-6(5)4-8/h1-3H |
InChIKey | MZZGCCSFZCRVAF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)C#N)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |