For research use only. Not for therapeutic Use.
3-Isopropyl-4-methoxyaniline(Cat No.:L014397)is an organic compound featuring both an isopropyl group and a methoxy group attached to an aniline ring. This structure offers unique electronic and steric properties, making it a versatile intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. The isopropyl group increases lipophilicity, enhancing solubility in organic solvents, while the methoxy group contributes to electron donation, improving reactivity. 3-Isopropyl-4-methoxyaniline is particularly valuable in creating compounds that require specific pharmacological activities, aiding in the development of innovative therapeutic agents and industrial chemicals.
CAS Number | 91251-42-2 |
Molecular Formula | C10H15NO |
Purity | ≥95% |
IUPAC Name | 4-methoxy-3-propan-2-ylaniline |
InChI | InChI=1S/C10H15NO/c1-7(2)9-6-8(11)4-5-10(9)12-3/h4-7H,11H2,1-3H3 |
InChIKey | IQZLIGNZLCVEKN-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C=CC(=C1)N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |