For research use only. Not for therapeutic Use.
3-Isothiazolecarboxamide is an organic compound characterized by an isothiazole ring with a carboxamide group (-C(O)NH₂) at the third position. Its chemical formula is C₄H₄N₂O. This compound is notable for its potential biological activities, including antibacterial and antifungal properties, making it of interest in medicinal chemistry. The unique structure of the isothiazole ring, combined with the carboxamide functionality, allows for diverse chemical reactivity, positioning it as a valuable building block for the development of various pharmaceuticals and agrochemicals.
| Catalog Number | L025841 |
| CAS Number | 24342-43-6 |
| Molecular Formula | C4H4N2OS |
| Purity | ≥95% |
| IUPAC Name | 1,2-thiazole-3-carboxamide |
| InChI | InChI=1S/C4H4N2OS/c5-4(7)3-1-2-8-6-3/h1-2H,(H2,5,7) |
| InChIKey | LPDNEYZLRXGBKO-UHFFFAOYSA-N |
| SMILES | C1=CSN=C1C(=O)N |
