For research use only. Not for therapeutic Use.
3-MeOARh-NTR(Cat No.:I041371)is a synthetic compound that functions as a selective ligand for the neurotensin receptor (NTR). Neurotensin receptors are involved in various physiological processes, including modulation of neurotransmitter release, pain perception, and regulation of body temperature. 3-MeOARh-NTR is designed to bind specifically to these receptors, making it a valuable tool in neuroscience research. By activating or blocking NTR, it allows for the investigation of neurotensin pathways in the brain and their potential implications in disorders such as schizophrenia, pain, and neurodegenerative diseases. Ongoing research explores its potential therapeutic applications.
Synonyms | [9-(2-carboxyphenyl)-7-methoxy-6-[(4-nitrophenyl)methoxycarbonylamino]xanthen-3-ylidene]-diethylazanium |
Molecular Formula | C33H30N3O8+ |
Purity | ≥95% |
IUPAC Name | [9-(2-carboxyphenyl)-7-methoxy-6-[(4-nitrophenyl)methoxycarbonylamino]xanthen-3-ylidene]-diethylazanium |
InChI | InChI=1S/C33H29N3O8/c1-4-35(5-2)22-14-15-25-28(16-22)44-29-18-27(34-33(39)43-19-20-10-12-21(13-11-20)36(40)41)30(42-3)17-26(29)31(25)23-8-6-7-9-24(23)32(37)38/h6-18H,4-5,19H2,1-3H3,(H,37,38)/p+1 |
InChIKey | DIXSWIOVQOAGAZ-UHFFFAOYSA-O |
SMILES | CC[N+](=C1C=CC2=C(C3=CC(=C(C=C3OC2=C1)NC(=O)OCC4=CC=C(C=C4)[N+](=O)[O-])OC)C5=CC=CC=C5C(=O)O)CC |