For research use only. Not for therapeutic Use.
3-Mercaptopicolinic acid is an inhibitor of gluconeogenesis. In perfused rat livers, gluconeogenesis was inhibited when lactate, pyruvate, or alanine served as substrate, but not with fructose, suggesting phosphoenolpyruvate carboxykinase as the site of inhibition.
| CAS Number | 320386-54-7 |
| Synonyms | 3-Mercapto-2-pyridinecarboxylic Acid Hydrochloride; |
| Molecular Formula | C6H6ClNO2S |
| Purity | ≥95% |
| Target | PEPCK |
| Storage | -20°C |
| IUPAC Name | 3-sulfanylpyridine-2-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C6H5NO2S.ClH/c8-6(9)5-4(10)2-1-3-7-5;/h1-3,10H,(H,8,9);1H |
| InChIKey | DYGYEUUVNLEHJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)S.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
