For research use only. Not for therapeutic Use.
3-Methanesulfinylpropan-1-amine(Cat No.:L007492), is a chemical compound of interest in the realm of organic chemistry. Its molecular structure features a propan-1-amine backbone with a methanesulfinyl (methylsulfinyl) group attached. This compound is significant due to its potential applications in pharmaceutical research and agrochemicals. Researchers explore its unique chemical properties, studying its reactivity and biological effects. Such investigations are crucial for developing novel drugs or pesticides.
CAS Number | 196200-06-3 |
Molecular Formula | C4H11NOS |
Purity | ≥95% |
IUPAC Name | 3-methylsulfinylpropan-1-amine |
InChI | InChI=1S/C4H11NOS/c1-7(6)4-2-3-5/h2-5H2,1H3 |
InChIKey | COPMQUUNXNNQJO-UHFFFAOYSA-N |
SMILES | CS(=O)CCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |