For research use only. Not for therapeutic Use.
3-Methoxy-α-methyl-L-tyrosine(CAT: R042688) is a synthetic amino acid derivative often used in biochemical and pharmaceutical research. This compound, featuring a methoxy group at the 3rd position and an α-methyl modification, is primarily used to investigate dopaminergic pathways and neurotransmitter synthesis. It plays a significant role in studying enzyme kinetics, particularly in relation to tyrosine hydroxylase, an enzyme crucial for dopamine synthesis. The structural modifications in this compound allow researchers to explore its effects on metabolism and potential therapeutic applications in neurological conditions. Its stability and unique properties make it valuable for drug discovery and neuropharmacology research.
CAS Number | 6739-31-7 |
Synonyms | L-4-Hydroxy-3-methoxy-α-methylphenylalanine; |
Molecular Formula | C11H15NO4 |
Purity | ≥95% |
Storage | +4 ℃ |
IUPAC Name | (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoic acid |
InChI | InChI=1S/C11H15NO4/c1-11(12,10(14)15)6-7-3-4-8(13)9(5-7)16-2/h3-5,13H,6,12H2,1-2H3,(H,14,15)/t11-/m0/s1 |
InChIKey | BQHWFYPBSKGBMV-NSHDSACASA-N |
SMILES | CC(CC1=CC(=C(C=C1)O)OC)(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |