For research use only. Not for therapeutic Use.
3-Methoxy-2,6-dimethylaniline(CAT: L000207) is a crucial compound in organic chemistry, particularly in the synthesis of pharmaceutical and organic molecules. This compound serves as a valuable building block for creating various organic intermediates and pharmaceutical agents. Its chemical structure allows for selective functional group modifications, making it an essential component for researchers working to design and synthesize complex molecules.
CAS Number | 95645-00-4 |
Molecular Formula | C9H13NO |
Purity | ≥95% |
IUPAC Name | 3-methoxy-2,6-dimethylaniline |
InChI | InChI=1S/C9H13NO/c1-6-4-5-8(11-3)7(2)9(6)10/h4-5H,10H2,1-3H3 |
InChIKey | DBRPRHMYNICNTR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |