For research use only. Not for therapeutic Use.
3-Methoxy-4-(methoxycarbonyl)benzoic acid(Cat No.:L007580), is a chemical compound characterized by a benzoic acid core with a methoxy group at the 3-position and a methoxycarbonyl (ester) group at the 4-position. This unique structure provides versatility in organic synthesis, making it valuable in pharmaceutical research and materials science. Scientists utilize this compound as a building block for the synthesis of complex organic molecules.
CAS Number | 162046-51-7 |
Molecular Formula | C10H10O5 |
Purity | ≥95% |
IUPAC Name | 3-methoxy-4-methoxycarbonylbenzoic acid |
InChI | InChI=1S/C10H10O5/c1-14-8-5-6(9(11)12)3-4-7(8)10(13)15-2/h3-5H,1-2H3,(H,11,12) |
InChIKey | MAIDVTUHEDEKMF-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C(=O)O)C(=O)OC |