For research use only. Not for therapeutic Use.
3-Methoxy-4-nitro-1H-pyrazole(CAT: L037561) is a heterocyclic compound featuring a pyrazole ring with a methoxy group at the 3-position and a nitro group at the 4-position. This compound is of interest in medicinal chemistry and organic synthesis, where the pyrazole ring system is frequently used as a building block for bioactive molecules. The presence of both electron-donating (methoxy) and electron-withdrawing (nitro) groups on the ring enhances its reactivity, making it suitable for various chemical transformations and functionalizations. It can be employed in the synthesis of pharmaceutical intermediates, agrochemicals, and as a potential lead compound in the development of new therapeutic agents due to the biological relevance of pyrazole derivatives.
Catalog Number | L037561 |
CAS Number | 400755-41-1 |
Molecular Formula | C4H5N3O3 |
Purity | ≥95% |
IUPAC Name | 5-methoxy-4-nitro-1H-pyrazole |
InChI | InChI=1S/C4H5N3O3/c1-10-4-3(7(8)9)2-5-6-4/h2H,1H3,(H,5,6) |
InChIKey | GLNYWXCDHONDOZ-UHFFFAOYSA-N |