For research use only. Not for therapeutic Use.
3-Methoxy-D-phenylalanine(Cat No.:M091290)is a specialized amino acid derivative used in pharmaceutical research and development, particularly in the synthesis of peptide-based drugs and bioactive compounds. The methoxy group on the phenyl ring enhances the compound’s chemical properties, potentially altering its interaction with biological targets. As a D-enantiomer, it offers unique stereochemistry, making it valuable for studying enantiomer-specific activity in drug design. Researchers rely on this high-purity compound for exploring new therapeutic agents, optimizing drug candidates, and investigating novel pathways in medicinal chemistry.
CAS Number | 145306-65-6 |
Molecular Formula | C10H13NO3 |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-3-(3-methoxyphenyl)propanoic acid |
InChI | InChI=1S/C10H13NO3/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1 |
InChIKey | XTXGLOBWOMUGQB-SECBINFHSA-N |
SMILES | COC1=CC=CC(=C1)CC(C(=O)O)N |